C11H10Br2N2S — CID 171219021
2-[(R)-amino(thiophen-3-yl)methyl]-4,6-dibromoaniline (PubChem CID 171219021) has the molecular formula C11H10Br2N2S and a molecular weight of 362.09 g/mol. Its IUPAC name is 2-[(R)-amino(thiophen-3-yl)methyl]-4,6-dibromoaniline.
| Compound Name | 2-[(R)-amino(thiophen-3-yl)methyl]-4,6-dibromoaniline |
|---|---|
| PubChem CID | 171219021 |
| Molecular Formula | C11H10Br2N2S |
| Molecular Weight | 362.09 g/mol |
| Exact Mass | 359.89 |
| IUPAC Name | 2-[(R)-amino(thiophen-3-yl)methyl]-4,6-dibromoaniline |
| SMILES | Nc1c(Br)cc(Br)cc1[C@@H](N)c1ccsc1 |
| InChI | InChI=1S/C11H10Br2N2S/c12-7-3-8(11(15)9(13)4-7)10(14)6-1-2-16-5-6/h1-5,10H,14-15H2/t10-/m0/s1 |
| InChIKey | LDBUAFMWUVOAFT-JTQLQIEISA-N |
| XLogP | 3.90 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.09 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|