C10H15Br2N3 — CID 171199462
(1R)-1-(2-amino-3,5-dibromophenyl)butane-1,4-diamine (PubChem CID 171199462) has the molecular formula C10H15Br2N3 and a molecular weight of 337.06 g/mol. Its IUPAC name is (1R)-1-(2-amino-3,5-dibromophenyl)butane-1,4-diamine.
| Compound Name | (1R)-1-(2-amino-3,5-dibromophenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 171199462 |
| Molecular Formula | C10H15Br2N3 |
| Molecular Weight | 337.06 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | (1R)-1-(2-amino-3,5-dibromophenyl)butane-1,4-diamine |
| SMILES | NCCC[C@@H](N)c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C10H15Br2N3/c11-6-4-7(9(14)2-1-3-13)10(15)8(12)5-6/h4-5,9H,1-3,13-15H2/t9-/m1/s1 |
| InChIKey | CMVJJPVEWXCWDC-SECBINFHSA-N |
| XLogP | 2.53 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.06 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|