C10H13BrF2N2 — CID 171226270
(1S)-1-(4-bromo-2,6-difluorophenyl)butane-1,4-diamine (PubChem CID 171226270) has the molecular formula C10H13BrF2N2 and a molecular weight of 279.13 g/mol. Its IUPAC name is (1S)-1-(4-bromo-2,6-difluorophenyl)butane-1,4-diamine.
| Compound Name | (1S)-1-(4-bromo-2,6-difluorophenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 171226270 |
| Molecular Formula | C10H13BrF2N2 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | (1S)-1-(4-bromo-2,6-difluorophenyl)butane-1,4-diamine |
| SMILES | NCCC[C@H](N)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C10H13BrF2N2/c11-6-4-7(12)10(8(13)5-6)9(15)2-1-3-14/h4-5,9H,1-3,14-15H2/t9-/m0/s1 |
| InChIKey | RIGVUBKAASOCSA-VIFPVBQESA-N |
| XLogP | 2.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |