C11H10BrF2N — CID 115859648
1-(4-bromo-2,6-difluorophenyl)pent-4-yn-1-amine (PubChem CID 115859648) has the molecular formula C11H10BrF2N and a molecular weight of 274.11 g/mol. Its IUPAC name is 1-(4-bromo-2,6-difluorophenyl)pent-4-yn-1-amine.
| Compound Name | 1-(4-bromo-2,6-difluorophenyl)pent-4-yn-1-amine |
|---|---|
| PubChem CID | 115859648 |
| Molecular Formula | C11H10BrF2N |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 1-(4-bromo-2,6-difluorophenyl)pent-4-yn-1-amine |
| SMILES | C#CCCC(N)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H10BrF2N/c1-2-3-4-10(15)11-8(13)5-7(12)6-9(11)14/h1,5-6,10H,3-4,15H2 |
| InChIKey | PZEAFIIBTZGQPZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|