C11H10F3N — CID 63657908
1-(3,4,5-trifluorophenyl)pent-4-yn-1-amine (PubChem CID 63657908) has the molecular formula C11H10F3N and a molecular weight of 213.20 g/mol. Its IUPAC name is 1-(3,4,5-trifluorophenyl)pent-4-yn-1-amine.
| Compound Name | 1-(3,4,5-trifluorophenyl)pent-4-yn-1-amine |
|---|---|
| PubChem CID | 63657908 |
| Molecular Formula | C11H10F3N |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1-(3,4,5-trifluorophenyl)pent-4-yn-1-amine |
| SMILES | C#CCCC(N)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H10F3N/c1-2-3-4-10(15)7-5-8(12)11(14)9(13)6-7/h1,5-6,10H,3-4,15H2 |
| InChIKey | HXWNTMBRFMPYRE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|