C9H10F3N — CID 55255857
(1S)-1-(3,4,5-trifluorophenyl)propan-1-amine (PubChem CID 55255857) has the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. Its IUPAC name is (1S)-1-(3,4,5-trifluorophenyl)propan-1-amine.
| Compound Name | (1S)-1-(3,4,5-trifluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 55255857 |
| Molecular Formula | C9H10F3N |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (1S)-1-(3,4,5-trifluorophenyl)propan-1-amine |
| SMILES | CC[C@H](N)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C9H10F3N/c1-2-8(13)5-3-6(10)9(12)7(11)4-5/h3-4,8H,2,13H2,1H3/t8-/m0/s1 |
| InChIKey | IOABMNGPNFPERE-QMMMGPOBSA-N |
| XLogP | 2.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|