C22H24F5NO — CID 130203765
1-[3,5-difluoro-4-[[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]phenyl]propan-1-amine (PubChem CID 130203765) has the molecular formula C22H24F5NO and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]phenyl]propan-1-amine.
| Compound Name | 1-[3,5-difluoro-4-[[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 130203765 |
| Molecular Formula | C22H24F5NO |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 1-[3,5-difluoro-4-[[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]phenyl]propan-1-amine |
| SMILES | CCC(N)c1cc(F)c(OCC2CCC(c3cc(F)c(F)c(F)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C22H24F5NO/c1-2-20(28)15-9-18(25)22(19(26)10-15)29-11-12-3-5-13(6-4-12)14-7-16(23)21(27)17(24)8-14/h7-10,12-13,20H,2-6,11,28H2,1H3 |
| InChIKey | JRDJOIQHUSRXBB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|