C25H19F7O — CID 134560861
5-[4-[(2,6-difluorophenoxy)methyl]cyclohexyl]-1,3-difluoro-2-(3,4,5-trifluorophenyl)benzene (PubChem CID 134560861) has the molecular formula C25H19F7O and a molecular weight of 468.41 g/mol. Its IUPAC name is 5-[4-[(2,6-difluorophenoxy)methyl]cyclohexyl]-1,3-difluoro-2-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 5-[4-[(2,6-difluorophenoxy)methyl]cyclohexyl]-1,3-difluoro-2-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 134560861 |
| Molecular Formula | C25H19F7O |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 5-[4-[(2,6-difluorophenoxy)methyl]cyclohexyl]-1,3-difluoro-2-(3,4,5-trifluorophenyl)benzene |
| SMILES | Fc1cc(-c2c(F)cc(C3CCC(COc4c(F)cccc4F)CC3)cc2F)cc(F)c1F |
| InChI | InChI=1S/C25H19F7O/c26-17-2-1-3-18(27)25(17)33-12-13-4-6-14(7-5-13)15-8-19(28)23(20(29)9-15)16-10-21(30)24(32)22(31)11-16/h1-3,8-11,13-14H,4-7,12H2 |
| InChIKey | OEYFGLKPFLLUAT-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|