C23H25F5O — CID 130191401
5-butyl-1,3-difluoro-2-[[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]benzene (PubChem CID 130191401) has the molecular formula C23H25F5O and a molecular weight of 412.44 g/mol. Its IUPAC name is 5-butyl-1,3-difluoro-2-[[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]benzene.
| Compound Name | 5-butyl-1,3-difluoro-2-[[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]benzene |
|---|---|
| PubChem CID | 130191401 |
| Molecular Formula | C23H25F5O |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 5-butyl-1,3-difluoro-2-[[4-(3,4,5-trifluorophenyl)cyclohexyl]methoxy]benzene |
| SMILES | CCCCc1cc(F)c(OCC2CCC(c3cc(F)c(F)c(F)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C23H25F5O/c1-2-3-4-15-9-20(26)23(21(27)10-15)29-13-14-5-7-16(8-6-14)17-11-18(24)22(28)19(25)12-17/h9-12,14,16H,2-8,13H2,1H3 |
| InChIKey | LBQGWXQCLJENSP-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|