C30H30F6O — CID 130191423
1,3-difluoro-2-[[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]methoxy]-5-pentylbenzene (PubChem CID 130191423) has the molecular formula C30H30F6O and a molecular weight of 520.56 g/mol. Its IUPAC name is 1,3-difluoro-2-[[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]methoxy]-5-pentylbenzene.
| Compound Name | 1,3-difluoro-2-[[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]methoxy]-5-pentylbenzene |
|---|---|
| PubChem CID | 130191423 |
| Molecular Formula | C30H30F6O |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 1,3-difluoro-2-[[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]methoxy]-5-pentylbenzene |
| SMILES | CCCCCc1cc(F)c(OCC2CCC(c3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C30H30F6O/c1-2-3-4-5-19-12-27(34)30(28(35)13-19)37-17-18-6-8-20(9-7-18)21-10-11-23(24(31)14-21)22-15-25(32)29(36)26(33)16-22/h10-16,18,20H,2-9,17H2,1H3 |
| InChIKey | QRDVRZSHGSIFBF-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|