C28H26F6O2 — CID 130191374
5-butyl-2-[4-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]-3-fluorophenyl]oxane (PubChem CID 130191374) has the molecular formula C28H26F6O2 and a molecular weight of 508.50 g/mol. Its IUPAC name is 5-butyl-2-[4-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]-3-fluorophenyl]oxane.
| Compound Name | 5-butyl-2-[4-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]-3-fluorophenyl]oxane |
|---|---|
| PubChem CID | 130191374 |
| Molecular Formula | C28H26F6O2 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 5-butyl-2-[4-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]-3-fluorophenyl]oxane |
| SMILES | CCCCC1CCC(c2ccc(-c3cc(F)c(OCc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C28H26F6O2/c1-2-3-4-16-5-8-26(35-14-16)18-6-7-20(21(29)11-18)19-12-24(32)28(25(33)13-19)36-15-17-9-22(30)27(34)23(31)10-17/h6-7,9-13,16,26H,2-5,8,14-15H2,1H3 |
| InChIKey | HJUPOMRUAMPHAT-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|