C28H35F5Si — CID 54458471
4-[2-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]ethyl]-1-propylsilinane (PubChem CID 54458471) has the molecular formula C28H35F5Si and a molecular weight of 494.66 g/mol. Its IUPAC name is 4-[2-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]ethyl]-1-propylsilinane.
| Compound Name | 4-[2-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]ethyl]-1-propylsilinane |
|---|---|
| PubChem CID | 54458471 |
| Molecular Formula | C28H35F5Si |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 4-[2-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]ethyl]-1-propylsilinane |
| SMILES | CCC[SiH]1CCC(CCC2CCC(c3cc(F)c(-c4cc(F)c(F)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H35F5Si/c1-2-11-34-12-9-19(10-13-34)4-3-18-5-7-20(8-6-18)21-14-23(29)27(24(30)15-21)22-16-25(31)28(33)26(32)17-22/h14-20,34H,2-13H2,1H3 |
| InChIKey | WZWZMQCZEYRUSK-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|