C24H35F5OSi — CID 54452078
4-[2-[4-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]cyclohexyl]ethyl]-1-propylsilinane (PubChem CID 54452078) has the molecular formula C24H35F5OSi and a molecular weight of 462.62 g/mol. Its IUPAC name is 4-[2-[4-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]cyclohexyl]ethyl]-1-propylsilinane.
| Compound Name | 4-[2-[4-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]cyclohexyl]ethyl]-1-propylsilinane |
|---|---|
| PubChem CID | 54452078 |
| Molecular Formula | C24H35F5OSi |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 4-[2-[4-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]cyclohexyl]ethyl]-1-propylsilinane |
| SMILES | CCC[SiH]1CCC(CCC2CCC(c3cc(F)c(OCC(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H35F5OSi/c1-2-11-31-12-9-18(10-13-31)4-3-17-5-7-19(8-6-17)20-14-21(25)23(22(26)15-20)30-16-24(27,28)29/h14-15,17-19,31H,2-13,16H2,1H3 |
| InChIKey | WVQCBOZRTCOOPT-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|