C25H37F5OSi — CID 54327159
4-[2-[4-[4-(2,2-difluoroethoxy)-3,5-difluorophenyl]cyclohexyl]ethyl]-1-(4-fluorobutyl)silinane (PubChem CID 54327159) has the molecular formula C25H37F5OSi and a molecular weight of 476.65 g/mol. Its IUPAC name is 4-[2-[4-[4-(2,2-difluoroethoxy)-3,5-difluorophenyl]cyclohexyl]ethyl]-1-(4-fluorobutyl)silinane.
| Compound Name | 4-[2-[4-[4-(2,2-difluoroethoxy)-3,5-difluorophenyl]cyclohexyl]ethyl]-1-(4-fluorobutyl)silinane |
|---|---|
| PubChem CID | 54327159 |
| Molecular Formula | C25H37F5OSi |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 4-[2-[4-[4-(2,2-difluoroethoxy)-3,5-difluorophenyl]cyclohexyl]ethyl]-1-(4-fluorobutyl)silinane |
| SMILES | FCCCC[SiH]1CCC(CCC2CCC(c3cc(F)c(OCC(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H37F5OSi/c26-11-1-2-12-32-13-9-19(10-14-32)4-3-18-5-7-20(8-6-18)21-15-22(27)25(23(28)16-21)31-17-24(29)30/h15-16,18-20,24,32H,1-14,17H2 |
| InChIKey | SVTQTMKMZNGTTM-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|