C19H27F3 — CID 20663479
1,3-difluoro-5-[4-(7-fluoroheptyl)cyclohexyl]benzene (PubChem CID 20663479) has the molecular formula C19H27F3 and a molecular weight of 312.42 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-(7-fluoroheptyl)cyclohexyl]benzene.
| Compound Name | 1,3-difluoro-5-[4-(7-fluoroheptyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 20663479 |
| Molecular Formula | C19H27F3 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1,3-difluoro-5-[4-(7-fluoroheptyl)cyclohexyl]benzene |
| SMILES | FCCCCCCCC1CCC(c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C19H27F3/c20-11-5-3-1-2-4-6-15-7-9-16(10-8-15)17-12-18(21)14-19(22)13-17/h12-16H,1-11H2 |
| InChIKey | DEMUSJPPEBAZKY-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|