C19H28F2 — CID 20663566
2-fluoro-4-[4-(6-fluorohexyl)cyclohexyl]-1-methylbenzene (PubChem CID 20663566) has the molecular formula C19H28F2 and a molecular weight of 294.43 g/mol. Its IUPAC name is 2-fluoro-4-[4-(6-fluorohexyl)cyclohexyl]-1-methylbenzene.
| Compound Name | 2-fluoro-4-[4-(6-fluorohexyl)cyclohexyl]-1-methylbenzene |
|---|---|
| PubChem CID | 20663566 |
| Molecular Formula | C19H28F2 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2-fluoro-4-[4-(6-fluorohexyl)cyclohexyl]-1-methylbenzene |
| SMILES | Cc1ccc(C2CCC(CCCCCCF)CC2)cc1F |
| InChI | InChI=1S/C19H28F2/c1-15-7-10-18(14-19(15)21)17-11-8-16(9-12-17)6-4-2-3-5-13-20/h7,10,14,16-17H,2-6,8-9,11-13H2,1H3 |
| InChIKey | MDCKGCYUXVOEIM-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|