C21H31F2Si — CID 20663586
CID 20663586 (PubChem CID 20663586) has the molecular formula C21H31F2Si and a molecular weight of 349.56 g/mol.
| Compound Name | CID 20663586 |
|---|---|
| PubChem CID | 20663586 |
| Molecular Formula | C21H31F2Si |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C2CCC(C3CC[Si](CCCF)CC3)CC2)cc1F |
| InChI | InChI=1S/C21H31F2Si/c1-16-3-4-20(15-21(16)23)18-7-5-17(6-8-18)19-9-13-24(14-10-19)12-2-11-22/h3-4,15,17-19H,2,5-14H2,1H3 |
| InChIKey | CFDRDDICVOKXBF-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|