C18H24FO2Si — CID 20632256
CID 20632256 (PubChem CID 20632256) has the molecular formula C18H24FO2Si and a molecular weight of 319.47 g/mol.
| Compound Name | CID 20632256 |
|---|---|
| PubChem CID | 20632256 |
| Molecular Formula | C18H24FO2Si |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C2CCC(C3OCC(C[Si])CO3)CC2)cc1F |
| InChI | InChI=1S/C18H24FO2Si/c1-12-2-3-16(8-17(12)19)14-4-6-15(7-5-14)18-20-9-13(11-22)10-21-18/h2-3,8,13-15,18H,4-7,9-11H2,1H3 |
| InChIKey | WNSGUJVDKXEVPF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|