C21H28F2O2 — CID 54191136
2-[4-(3,4-difluorophenyl)cyclohexyl]-5-pent-1-enyl-1,3-dioxane (PubChem CID 54191136) has the molecular formula C21H28F2O2 and a molecular weight of 350.45 g/mol. Its IUPAC name is 2-[4-(3,4-difluorophenyl)cyclohexyl]-5-pent-1-enyl-1,3-dioxane.
| Compound Name | 2-[4-(3,4-difluorophenyl)cyclohexyl]-5-pent-1-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 54191136 |
| Molecular Formula | C21H28F2O2 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-[4-(3,4-difluorophenyl)cyclohexyl]-5-pent-1-enyl-1,3-dioxane |
| SMILES | CCCC=CC1COC(C2CCC(c3ccc(F)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C21H28F2O2/c1-2-3-4-5-15-13-24-21(25-14-15)17-8-6-16(7-9-17)18-10-11-19(22)20(23)12-18/h4-5,10-12,15-17,21H,2-3,6-9,13-14H2,1H3 |
| InChIKey | PIPHHSCMILUCDW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|