C17H22F2 — CID 57091886
1,2-difluoro-4-(3-pent-1-enylcyclohexyl)benzene (PubChem CID 57091886) has the molecular formula C17H22F2 and a molecular weight of 264.36 g/mol. Its IUPAC name is 1,2-difluoro-4-(3-pent-1-enylcyclohexyl)benzene.
| Compound Name | 1,2-difluoro-4-(3-pent-1-enylcyclohexyl)benzene |
|---|---|
| PubChem CID | 57091886 |
| Molecular Formula | C17H22F2 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1,2-difluoro-4-(3-pent-1-enylcyclohexyl)benzene |
| SMILES | CCCC=CC1CCCC(c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C17H22F2/c1-2-3-4-6-13-7-5-8-14(11-13)15-9-10-16(18)17(19)12-15/h4,6,9-10,12-14H,2-3,5,7-8,11H2,1H3 |
| InChIKey | KHEJFOIFFPAVLB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|