C22H25F2N — CID 67823755
2-(3,4-difluorophenyl)-5-(4-pent-1-enylcyclohexyl)pyridine (PubChem CID 67823755) has the molecular formula C22H25F2N and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-5-(4-pent-1-enylcyclohexyl)pyridine.
| Compound Name | 2-(3,4-difluorophenyl)-5-(4-pent-1-enylcyclohexyl)pyridine |
|---|---|
| PubChem CID | 67823755 |
| Molecular Formula | C22H25F2N |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-(3,4-difluorophenyl)-5-(4-pent-1-enylcyclohexyl)pyridine |
| SMILES | CCCC=CC1CCC(c2ccc(-c3ccc(F)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C22H25F2N/c1-2-3-4-5-16-6-8-17(9-7-16)19-11-13-22(25-15-19)18-10-12-20(23)21(24)14-18/h4-5,10-17H,2-3,6-9H2,1H3 |
| InChIKey | GVBOQJATADTREU-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|