C24H25ClFN — CID 19386307
2-(4-chloro-3-fluorophenyl)-5-[2-[4-[(E)-pent-1-enyl]cyclohexyl]ethynyl]pyridine (PubChem CID 19386307) has the molecular formula C24H25ClFN and a molecular weight of 381.92 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-5-[2-[4-[(E)-pent-1-enyl]cyclohexyl]ethynyl]pyridine.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-5-[2-[4-[(E)-pent-1-enyl]cyclohexyl]ethynyl]pyridine |
|---|---|
| PubChem CID | 19386307 |
| Molecular Formula | C24H25ClFN |
| Molecular Weight | 381.92 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-5-[2-[4-[(E)-pent-1-enyl]cyclohexyl]ethynyl]pyridine |
| SMILES | CCC/C=C/C1CCC(C#Cc2ccc(-c3ccc(Cl)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C24H25ClFN/c1-2-3-4-5-18-6-8-19(9-7-18)10-11-20-12-15-24(27-17-20)21-13-14-22(25)23(26)16-21/h4-5,12-19H,2-3,6-9H2,1H3/b5-4+ |
| InChIKey | LAKLSXGQMVSVDG-SNAWJCMRSA-N |
| XLogP | 7.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.92 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|