C24H24ClF — CID 54507419
4-[4-[2-(4-but-1-enylcyclohexyl)ethynyl]phenyl]-1-chloro-2-fluorobenzene (PubChem CID 54507419) has the molecular formula C24H24ClF and a molecular weight of 366.91 g/mol. Its IUPAC name is 4-[4-[2-(4-but-1-enylcyclohexyl)ethynyl]phenyl]-1-chloro-2-fluorobenzene.
| Compound Name | 4-[4-[2-(4-but-1-enylcyclohexyl)ethynyl]phenyl]-1-chloro-2-fluorobenzene |
|---|---|
| PubChem CID | 54507419 |
| Molecular Formula | C24H24ClF |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-[4-[2-(4-but-1-enylcyclohexyl)ethynyl]phenyl]-1-chloro-2-fluorobenzene |
| SMILES | CCC=CC1CCC(C#Cc2ccc(-c3ccc(Cl)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C24H24ClF/c1-2-3-4-18-5-7-19(8-6-18)9-10-20-11-13-21(14-12-20)22-15-16-23(25)24(26)17-22/h3-4,11-19H,2,5-8H2,1H3 |
| InChIKey | YGRVGFBFYAVQIU-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|