C25H26F2 — CID 19386448
1,2-difluoro-4-[4-[2-(4-pent-4-enylcyclohexyl)ethynyl]phenyl]benzene (PubChem CID 19386448) has the molecular formula C25H26F2 and a molecular weight of 364.48 g/mol. Its IUPAC name is 1,2-difluoro-4-[4-[2-(4-pent-4-enylcyclohexyl)ethynyl]phenyl]benzene.
| Compound Name | 1,2-difluoro-4-[4-[2-(4-pent-4-enylcyclohexyl)ethynyl]phenyl]benzene |
|---|---|
| PubChem CID | 19386448 |
| Molecular Formula | C25H26F2 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1,2-difluoro-4-[4-[2-(4-pent-4-enylcyclohexyl)ethynyl]phenyl]benzene |
| SMILES | C=CCCCC1CCC(C#Cc2ccc(-c3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H26F2/c1-2-3-4-5-19-6-8-20(9-7-19)10-11-21-12-14-22(15-13-21)23-16-17-24(26)25(27)18-23/h2,12-20H,1,3-9H2 |
| InChIKey | BWLWQJKKZGOGQU-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|