C24H24F2 — CID 19386421
4-[4-[2-(4-but-3-enylcyclohexyl)ethynyl]phenyl]-1,2-difluorobenzene (PubChem CID 19386421) has the molecular formula C24H24F2 and a molecular weight of 350.45 g/mol. Its IUPAC name is 4-[4-[2-(4-but-3-enylcyclohexyl)ethynyl]phenyl]-1,2-difluorobenzene.
| Compound Name | 4-[4-[2-(4-but-3-enylcyclohexyl)ethynyl]phenyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 19386421 |
| Molecular Formula | C24H24F2 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 4-[4-[2-(4-but-3-enylcyclohexyl)ethynyl]phenyl]-1,2-difluorobenzene |
| SMILES | C=CCCC1CCC(C#Cc2ccc(-c3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C24H24F2/c1-2-3-4-18-5-7-19(8-6-18)9-10-20-11-13-21(14-12-20)22-15-16-23(25)24(26)17-22/h2,11-19H,1,3-8H2 |
| InChIKey | BSCRKJHCVWDOIR-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|