C27H35F3 — CID 70209835
1-[2-(4-but-3-enylcyclohexyl)ethyl]-4-[2-[4-(trifluoromethyl)cyclohexyl]ethynyl]benzene (PubChem CID 70209835) has the molecular formula C27H35F3 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-[2-(4-but-3-enylcyclohexyl)ethyl]-4-[2-[4-(trifluoromethyl)cyclohexyl]ethynyl]benzene.
| Compound Name | 1-[2-(4-but-3-enylcyclohexyl)ethyl]-4-[2-[4-(trifluoromethyl)cyclohexyl]ethynyl]benzene |
|---|---|
| PubChem CID | 70209835 |
| Molecular Formula | C27H35F3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 1-[2-(4-but-3-enylcyclohexyl)ethyl]-4-[2-[4-(trifluoromethyl)cyclohexyl]ethynyl]benzene |
| SMILES | C=CCCC1CCC(CCc2ccc(C#CC3CCC(C(F)(F)F)CC3)cc2)CC1 |
| InChI | InChI=1S/C27H35F3/c1-2-3-4-21-5-7-22(8-6-21)9-10-23-11-13-24(14-12-23)15-16-25-17-19-26(20-18-25)27(28,29)30/h2,11-14,21-22,25-26H,1,3-10,17-20H2 |
| InChIKey | NQYNDHHQEAKXBE-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|