C19H28 — CID 56624486
2-(4-pent-4-enylcyclohexyl)ethylbenzene (PubChem CID 56624486) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is 2-(4-pent-4-enylcyclohexyl)ethylbenzene.
| Compound Name | 2-(4-pent-4-enylcyclohexyl)ethylbenzene |
|---|---|
| PubChem CID | 56624486 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 2-(4-pent-4-enylcyclohexyl)ethylbenzene |
| SMILES | C=CCCCC1CCC(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H28/c1-2-3-5-8-18-12-15-19(16-13-18)14-11-17-9-6-4-7-10-17/h2,4,6-7,9-10,18-19H,1,3,5,8,11-16H2 |
| InChIKey | BCSSXCXJSYBTAE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|