C21H30 — CID 57017107
3-(4-hexa-1,5-dienylcyclohexyl)propylbenzene (PubChem CID 57017107) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 3-(4-hexa-1,5-dienylcyclohexyl)propylbenzene.
| Compound Name | 3-(4-hexa-1,5-dienylcyclohexyl)propylbenzene |
|---|---|
| PubChem CID | 57017107 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 3-(4-hexa-1,5-dienylcyclohexyl)propylbenzene |
| SMILES | C=CCCC=CC1CCC(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H30/c1-2-3-4-6-12-20-15-17-21(18-16-20)14-9-13-19-10-7-5-8-11-19/h2,5-8,10-12,20-21H,1,3-4,9,13-18H2 |
| InChIKey | IVWAAKPUSJMFQD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|