C15H26 — CID 123985466
1-but-3-enyl-4-pent-1-enylcyclohexane (PubChem CID 123985466) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 1-but-3-enyl-4-pent-1-enylcyclohexane.
| Compound Name | 1-but-3-enyl-4-pent-1-enylcyclohexane |
|---|---|
| PubChem CID | 123985466 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 1-but-3-enyl-4-pent-1-enylcyclohexane |
| SMILES | C=CCCC1CCC(C=CCCC)CC1 |
| InChI | InChI=1S/C15H26/c1-3-5-7-9-15-12-10-14(11-13-15)8-6-4-2/h4,7,9,14-15H,2-3,5-6,8,10-13H2,1H3 |
| InChIKey | NXIBFCYMCWTNLZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|