C21H36 — CID 173282061
1-ethyl-4-[(E)-4-(4-prop-1-enylcyclohexyl)but-1-enyl]cyclohexane (PubChem CID 173282061) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is 1-ethyl-4-[(E)-4-(4-prop-1-enylcyclohexyl)but-1-enyl]cyclohexane.
| Compound Name | 1-ethyl-4-[(E)-4-(4-prop-1-enylcyclohexyl)but-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 173282061 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 1-ethyl-4-[(E)-4-(4-prop-1-enylcyclohexyl)but-1-enyl]cyclohexane |
| SMILES | CC=CC1CCC(CC/C=C/C2CCC(CC)CC2)CC1 |
| InChI | InChI=1S/C21H36/c1-3-7-19-14-16-21(17-15-19)9-6-5-8-20-12-10-18(4-2)11-13-20/h3,5,7-8,18-21H,4,6,9-17H2,1-2H3/b7-3?,8-5+ |
| InChIKey | CVLPLQZWRWWFLT-UYZILBNMSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|