C29H48 — CID 139753585
1-ethyl-4-[1-[2-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-1-enyl]cyclohexyl]ethenyl]cyclohexane (PubChem CID 139753585) has the molecular formula C29H48 and a molecular weight of 396.70 g/mol. Its IUPAC name is 1-ethyl-4-[1-[2-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-1-enyl]cyclohexyl]ethenyl]cyclohexane.
| Compound Name | 1-ethyl-4-[1-[2-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-1-enyl]cyclohexyl]ethenyl]cyclohexane |
|---|---|
| PubChem CID | 139753585 |
| Molecular Formula | C29H48 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 396.38 |
| IUPAC Name | 1-ethyl-4-[1-[2-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-1-enyl]cyclohexyl]ethenyl]cyclohexane |
| SMILES | C=C(C1CCC(CC)CC1)C1CCCCC1/C=C/CCC1CCC(/C=C/C)CC1 |
| InChI | InChI=1S/C29H48/c1-4-10-25-15-17-26(18-16-25)11-6-7-12-28-13-8-9-14-29(28)23(3)27-21-19-24(5-2)20-22-27/h4,7,10,12,24-29H,3,5-6,8-9,11,13-22H2,1-2H3/b10-4+,12-7+ |
| InChIKey | FUUVSZZRVXSKBY-CMLRWQBOSA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|