C11H20 — CID 59981886
1-ethyl-4-[(E)-prop-1-enyl]cyclohexane (PubChem CID 59981886) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is 1-ethyl-4-[(E)-prop-1-enyl]cyclohexane.
| Compound Name | 1-ethyl-4-[(E)-prop-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 59981886 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 1-ethyl-4-[(E)-prop-1-enyl]cyclohexane |
| SMILES | C/C=C/C1CCC(CC)CC1 |
| InChI | InChI=1S/C11H20/c1-3-5-11-8-6-10(4-2)7-9-11/h3,5,10-11H,4,6-9H2,1-2H3/b5-3+ |
| InChIKey | CFQRHJMAFPUBDU-HWKANZROSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|