C26H42F2O — CID 91557947
(3S,4S)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-3-(4-prop-1-enylcyclohexyl)oxetane (PubChem CID 91557947) has the molecular formula C26H42F2O and a molecular weight of 408.62 g/mol. Its IUPAC name is (3S,4S)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-3-(4-prop-1-enylcyclohexyl)oxetane.
| Compound Name | (3S,4S)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-3-(4-prop-1-enylcyclohexyl)oxetane |
|---|---|
| PubChem CID | 91557947 |
| Molecular Formula | C26H42F2O |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | (3S,4S)-4-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-3-(4-prop-1-enylcyclohexyl)oxetane |
| SMILES | CC=CC1CCC([C@H]2[C@H](C3CCC(C4CCC(CC)CC4)CC3)OC2(F)F)CC1 |
| InChI | InChI=1S/C26H42F2O/c1-3-5-19-8-12-22(13-9-19)24-25(29-26(24,27)28)23-16-14-21(15-17-23)20-10-6-18(4-2)7-11-20/h3,5,18-25H,4,6-17H2,1-2H3/t18?,19?,20?,21?,22?,23?,24-,25-/m0/s1 |
| InChIKey | YHRQPCVUWGRLCM-IWGFZSLYSA-N |
| XLogP | 8.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|