C22H38 — CID 173281372
1-prop-1-enyl-4-[(Z)-4-(4-propylcyclohexyl)but-2-enyl]cyclohexane (PubChem CID 173281372) has the molecular formula C22H38 and a molecular weight of 302.55 g/mol. Its IUPAC name is 1-prop-1-enyl-4-[(Z)-4-(4-propylcyclohexyl)but-2-enyl]cyclohexane.
| Compound Name | 1-prop-1-enyl-4-[(Z)-4-(4-propylcyclohexyl)but-2-enyl]cyclohexane |
|---|---|
| PubChem CID | 173281372 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | 1-prop-1-enyl-4-[(Z)-4-(4-propylcyclohexyl)but-2-enyl]cyclohexane |
| SMILES | CC=CC1CCC(C/C=C\CC2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C22H38/c1-3-7-19-11-15-21(16-12-19)9-5-6-10-22-17-13-20(8-4-2)14-18-22/h3,5-7,19-22H,4,8-18H2,1-2H3/b6-5-,7-3? |
| InChIKey | ZTQFDWIDLCKHOY-CURWRNPISA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|