C24H40F2 — CID 71163863
1,3-difluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-5-(4-propylcyclohexyl)cyclohexane (PubChem CID 71163863) has the molecular formula C24H40F2 and a molecular weight of 366.58 g/mol. Its IUPAC name is 1,3-difluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-5-(4-propylcyclohexyl)cyclohexane.
| Compound Name | 1,3-difluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-5-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 71163863 |
| Molecular Formula | C24H40F2 |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | 1,3-difluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-5-(4-propylcyclohexyl)cyclohexane |
| SMILES | C/C=C/C1CCC(C2C(F)CC(C3CCC(CCC)CC3)CC2F)CC1 |
| InChI | InChI=1S/C24H40F2/c1-3-5-17-7-11-19(12-8-17)21-15-22(25)24(23(26)16-21)20-13-9-18(6-4-2)10-14-20/h4,6,17-24H,3,5,7-16H2,1-2H3/b6-4+ |
| InChIKey | MEJPFKUFXSSKKZ-GQCTYLIASA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|