C23H40 — CID 54563730
1-but-1-enyl-4-[4-(4-propylcyclohexyl)but-2-enyl]cyclohexane (PubChem CID 54563730) has the molecular formula C23H40 and a molecular weight of 316.57 g/mol. Its IUPAC name is 1-but-1-enyl-4-[4-(4-propylcyclohexyl)but-2-enyl]cyclohexane.
| Compound Name | 1-but-1-enyl-4-[4-(4-propylcyclohexyl)but-2-enyl]cyclohexane |
|---|---|
| PubChem CID | 54563730 |
| Molecular Formula | C23H40 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | 1-but-1-enyl-4-[4-(4-propylcyclohexyl)but-2-enyl]cyclohexane |
| SMILES | CCC=CC1CCC(CC=CCC2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C23H40/c1-3-5-9-21-16-18-23(19-17-21)11-7-6-10-22-14-12-20(8-4-2)13-15-22/h5-7,9,20-23H,3-4,8,10-19H2,1-2H3 |
| InChIKey | ZSJOETAVVWEKND-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|