C32H54 — CID 139753577
1-pentyl-4-[1-[2-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-1-enyl]cyclohexyl]ethenyl]cyclohexane (PubChem CID 139753577) has the molecular formula C32H54 and a molecular weight of 438.78 g/mol. Its IUPAC name is 1-pentyl-4-[1-[2-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-1-enyl]cyclohexyl]ethenyl]cyclohexane.
| Compound Name | 1-pentyl-4-[1-[2-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-1-enyl]cyclohexyl]ethenyl]cyclohexane |
|---|---|
| PubChem CID | 139753577 |
| Molecular Formula | C32H54 |
| Molecular Weight | 438.78 g/mol |
| Exact Mass | 438.42 |
| IUPAC Name | 1-pentyl-4-[1-[2-[(E)-4-[4-[(E)-prop-1-enyl]cyclohexyl]but-1-enyl]cyclohexyl]ethenyl]cyclohexane |
| SMILES | C=C(C1CCC(CCCCC)CC1)C1CCCCC1/C=C/CCC1CCC(/C=C/C)CC1 |
| InChI | InChI=1S/C32H54/c1-4-6-7-13-29-22-24-30(25-23-29)26(3)32-17-11-10-16-31(32)15-9-8-14-28-20-18-27(12-5-2)19-21-28/h5,9,12,15,27-32H,3-4,6-8,10-11,13-14,16-25H2,1-2H3/b12-5+,15-9+ |
| InChIKey | SIQADOYZABQYRZ-QEOZMODRSA-N |
| XLogP | 10.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.78 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|