C20H36 — CID 123569351
1-non-1-enyl-4-pent-3-enylcyclohexane (PubChem CID 123569351) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 1-non-1-enyl-4-pent-3-enylcyclohexane.
| Compound Name | 1-non-1-enyl-4-pent-3-enylcyclohexane |
|---|---|
| PubChem CID | 123569351 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 1-non-1-enyl-4-pent-3-enylcyclohexane |
| SMILES | CC=CCCC1CCC(C=CCCCCCCC)CC1 |
| InChI | InChI=1S/C20H36/c1-3-5-7-8-9-10-12-14-20-17-15-19(16-18-20)13-11-6-4-2/h4,6,12,14,19-20H,3,5,7-11,13,15-18H2,1-2H3 |
| InChIKey | BFYXGKPHNLOBFR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|