C23H25F2N — CID 167218017
2,6-difluoro-4-[4-[2-(4-propylcyclohexyl)ethynyl]phenyl]aniline (PubChem CID 167218017) has the molecular formula C23H25F2N and a molecular weight of 353.46 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-[2-(4-propylcyclohexyl)ethynyl]phenyl]aniline.
| Compound Name | 2,6-difluoro-4-[4-[2-(4-propylcyclohexyl)ethynyl]phenyl]aniline |
|---|---|
| PubChem CID | 167218017 |
| Molecular Formula | C23H25F2N |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2,6-difluoro-4-[4-[2-(4-propylcyclohexyl)ethynyl]phenyl]aniline |
| SMILES | CCCC1CCC(C#Cc2ccc(-c3cc(F)c(N)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C23H25F2N/c1-2-3-16-4-6-17(7-5-16)8-9-18-10-12-19(13-11-18)20-14-21(24)23(26)22(25)15-20/h10-17H,2-7,26H2,1H3 |
| InChIKey | SKMDWCKDNDIIMN-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|