C21H28 — CID 139750856
1-[(E)-but-1-enyl]-4-[2-(4-propylcyclohexyl)ethynyl]benzene (PubChem CID 139750856) has the molecular formula C21H28 and a molecular weight of 280.46 g/mol. Its IUPAC name is 1-[(E)-but-1-enyl]-4-[2-(4-propylcyclohexyl)ethynyl]benzene.
| Compound Name | 1-[(E)-but-1-enyl]-4-[2-(4-propylcyclohexyl)ethynyl]benzene |
|---|---|
| PubChem CID | 139750856 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-[(E)-but-1-enyl]-4-[2-(4-propylcyclohexyl)ethynyl]benzene |
| SMILES | CC/C=C/c1ccc(C#CC2CCC(CCC)CC2)cc1 |
| InChI | InChI=1S/C21H28/c1-3-5-7-19-10-14-21(15-11-19)17-16-20-12-8-18(6-4-2)9-13-20/h5,7,10-11,14-15,18,20H,3-4,6,8-9,12-13H2,1-2H3/b7-5+ |
| InChIKey | SLDZDUWOFWONSU-FNORWQNLSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|