C47H48N2 — CID 70383381
4-[4-[2-(4-ethylcyclohexyl)ethynyl]phenyl]benzonitrile;4-[4-[2-(4-propylcyclohexyl)ethynyl]phenyl]benzonitrile (PubChem CID 70383381) has the molecular formula C47H48N2 and a molecular weight of 640.92 g/mol. Its IUPAC name is 4-[4-[2-(4-ethylcyclohexyl)ethynyl]phenyl]benzonitrile;4-[4-[2-(4-propylcyclohexyl)ethynyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[2-(4-ethylcyclohexyl)ethynyl]phenyl]benzonitrile;4-[4-[2-(4-propylcyclohexyl)ethynyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 70383381 |
| Molecular Formula | C47H48N2 |
| Molecular Weight | 640.92 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | 4-[4-[2-(4-ethylcyclohexyl)ethynyl]phenyl]benzonitrile;4-[4-[2-(4-propylcyclohexyl)ethynyl]phenyl]benzonitrile |
| SMILES | CCC1CCC(C#Cc2ccc(-c3ccc(C#N)cc3)cc2)CC1.CCCC1CCC(C#Cc2ccc(-c3ccc(C#N)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H25N.C23H23N/c1-2-3-19-4-6-20(7-5-19)8-9-21-10-14-23(15-11-21)24-16-12-22(18-25)13-17-24;1-2-18-3-5-19(6-4-18)7-8-20-9-13-22(14-10-20)23-15-11-21(17-24)12-16-23/h10-17,19-20H,2-7H2,1H3;9-16,18-19H,2-6H2,1H3 |
| InChIKey | HBHNZDHTIDCENZ-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.92 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|