C21H25F5 — CID 19983999
1-(1,1,2,2,2-pentafluoroethyl)-4-[2-(4-pentylcyclohexyl)ethynyl]benzene (PubChem CID 19983999) has the molecular formula C21H25F5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethyl)-4-[2-(4-pentylcyclohexyl)ethynyl]benzene.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethyl)-4-[2-(4-pentylcyclohexyl)ethynyl]benzene |
|---|---|
| PubChem CID | 19983999 |
| Molecular Formula | C21H25F5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethyl)-4-[2-(4-pentylcyclohexyl)ethynyl]benzene |
| SMILES | CCCCCC1CCC(C#Cc2ccc(C(F)(F)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H25F5/c1-2-3-4-5-16-6-8-17(9-7-16)10-11-18-12-14-19(15-13-18)20(22,23)21(24,25)26/h12-17H,2-9H2,1H3 |
| InChIKey | FGONJJBPVRUHAT-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|