C29H31F3O — CID 102017850
2-methyl-1-[2-(4-pentylcyclohexyl)ethynyl]-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene (PubChem CID 102017850) has the molecular formula C29H31F3O and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-pentylcyclohexyl)ethynyl]-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene.
| Compound Name | 2-methyl-1-[2-(4-pentylcyclohexyl)ethynyl]-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 102017850 |
| Molecular Formula | C29H31F3O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-methyl-1-[2-(4-pentylcyclohexyl)ethynyl]-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene |
| SMILES | CCCCCC1CCC(C#Cc2ccc(C#Cc3ccc(OC(F)(F)F)cc3)cc2C)CC1 |
| InChI | InChI=1S/C29H31F3O/c1-3-4-5-6-23-7-9-24(10-8-23)13-17-27-18-14-26(21-22(27)2)12-11-25-15-19-28(20-16-25)33-29(30,31)32/h14-16,18-21,23-24H,3-10H2,1-2H3 |
| InChIKey | DCCVPTKSTDTDAZ-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|