C28H30F2 — CID 142641536
1,3-difluoro-5-(4-pent-4-ynylphenyl)-2-[2-(4-propylcyclohexyl)ethynyl]benzene (PubChem CID 142641536) has the molecular formula C28H30F2 and a molecular weight of 404.54 g/mol. Its IUPAC name is 1,3-difluoro-5-(4-pent-4-ynylphenyl)-2-[2-(4-propylcyclohexyl)ethynyl]benzene.
| Compound Name | 1,3-difluoro-5-(4-pent-4-ynylphenyl)-2-[2-(4-propylcyclohexyl)ethynyl]benzene |
|---|---|
| PubChem CID | 142641536 |
| Molecular Formula | C28H30F2 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 1,3-difluoro-5-(4-pent-4-ynylphenyl)-2-[2-(4-propylcyclohexyl)ethynyl]benzene |
| SMILES | C#CCCCc1ccc(-c2cc(F)c(C#CC3CCC(CCC)CC3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H30F2/c1-3-5-6-8-22-13-16-24(17-14-22)25-19-27(29)26(28(30)20-25)18-15-23-11-9-21(7-4-2)10-12-23/h1,13-14,16-17,19-21,23H,4-12H2,2H3 |
| InChIKey | QHTONMQRSWQBTJ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|