C27H30F2 — CID 70207709
2-[2-(4-ethylcyclohexyl)ethynyl]-1,3-difluoro-5-(4-pent-1-en-3-ylphenyl)benzene (PubChem CID 70207709) has the molecular formula C27H30F2 and a molecular weight of 392.53 g/mol. Its IUPAC name is 2-[2-(4-ethylcyclohexyl)ethynyl]-1,3-difluoro-5-(4-pent-1-en-3-ylphenyl)benzene.
| Compound Name | 2-[2-(4-ethylcyclohexyl)ethynyl]-1,3-difluoro-5-(4-pent-1-en-3-ylphenyl)benzene |
|---|---|
| PubChem CID | 70207709 |
| Molecular Formula | C27H30F2 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-[2-(4-ethylcyclohexyl)ethynyl]-1,3-difluoro-5-(4-pent-1-en-3-ylphenyl)benzene |
| SMILES | C=CC(CC)c1ccc(-c2cc(F)c(C#CC3CCC(CC)CC3)c(F)c2)cc1 |
| InChI | InChI=1S/C27H30F2/c1-4-19-7-9-20(10-8-19)11-16-25-26(28)17-24(18-27(25)29)23-14-12-22(13-15-23)21(5-2)6-3/h5,12-15,17-21H,2,4,6-10H2,1,3H3 |
| InChIKey | UFLNYAVVLAJXKJ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|