C29H40F2 — CID 70209618
2-[2-(4-ethylcyclohexyl)ethynyl]-1,3-difluoro-5-[2-(4-pent-1-en-3-ylcyclohexyl)ethyl]benzene (PubChem CID 70209618) has the molecular formula C29H40F2 and a molecular weight of 426.64 g/mol. Its IUPAC name is 2-[2-(4-ethylcyclohexyl)ethynyl]-1,3-difluoro-5-[2-(4-pent-1-en-3-ylcyclohexyl)ethyl]benzene.
| Compound Name | 2-[2-(4-ethylcyclohexyl)ethynyl]-1,3-difluoro-5-[2-(4-pent-1-en-3-ylcyclohexyl)ethyl]benzene |
|---|---|
| PubChem CID | 70209618 |
| Molecular Formula | C29H40F2 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | 2-[2-(4-ethylcyclohexyl)ethynyl]-1,3-difluoro-5-[2-(4-pent-1-en-3-ylcyclohexyl)ethyl]benzene |
| SMILES | C=CC(CC)C1CCC(CCc2cc(F)c(C#CC3CCC(CC)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C29H40F2/c1-4-21-7-9-22(10-8-21)15-18-27-28(30)19-24(20-29(27)31)12-11-23-13-16-26(17-14-23)25(5-2)6-3/h5,19-23,25-26H,2,4,6-14,16-17H2,1,3H3 |
| InChIKey | CUVGVFHREINXPR-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|