C26H33F3O — CID 70210612
1-(4-pent-1-en-3-ylcyclohexyl)-4-[2-[4-(trifluoromethoxy)cyclohexyl]ethynyl]benzene (PubChem CID 70210612) has the molecular formula C26H33F3O and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-(4-pent-1-en-3-ylcyclohexyl)-4-[2-[4-(trifluoromethoxy)cyclohexyl]ethynyl]benzene.
| Compound Name | 1-(4-pent-1-en-3-ylcyclohexyl)-4-[2-[4-(trifluoromethoxy)cyclohexyl]ethynyl]benzene |
|---|---|
| PubChem CID | 70210612 |
| Molecular Formula | C26H33F3O |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 1-(4-pent-1-en-3-ylcyclohexyl)-4-[2-[4-(trifluoromethoxy)cyclohexyl]ethynyl]benzene |
| SMILES | C=CC(CC)C1CCC(c2ccc(C#CC3CCC(OC(F)(F)F)CC3)cc2)CC1 |
| InChI | InChI=1S/C26H33F3O/c1-3-21(4-2)22-13-15-24(16-14-22)23-11-7-19(8-12-23)5-6-20-9-17-25(18-10-20)30-26(27,28)29/h3,7-8,11-12,20-22,24-25H,1,4,9-10,13-18H2,2H3 |
| InChIKey | MNEHMXQPEDADQI-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|