C21H25ClF2 — CID 173348223
2-[2-[4-(2-chloroethenyl)cyclohexyl]ethynyl]-1,3-difluoro-5-pentylbenzene (PubChem CID 173348223) has the molecular formula C21H25ClF2 and a molecular weight of 350.88 g/mol. Its IUPAC name is 2-[2-[4-(2-chloroethenyl)cyclohexyl]ethynyl]-1,3-difluoro-5-pentylbenzene.
| Compound Name | 2-[2-[4-(2-chloroethenyl)cyclohexyl]ethynyl]-1,3-difluoro-5-pentylbenzene |
|---|---|
| PubChem CID | 173348223 |
| Molecular Formula | C21H25ClF2 |
| Molecular Weight | 350.88 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-[2-[4-(2-chloroethenyl)cyclohexyl]ethynyl]-1,3-difluoro-5-pentylbenzene |
| SMILES | CCCCCc1cc(F)c(C#CC2CCC(C=CCl)CC2)c(F)c1 |
| InChI | InChI=1S/C21H25ClF2/c1-2-3-4-5-18-14-20(23)19(21(24)15-18)11-10-16-6-8-17(9-7-16)12-13-22/h12-17H,2-9H2,1H3 |
| InChIKey | DQQJHFGFDOTLFB-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.88 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|