C30H28F6 — CID 139847124
6-[2-[4-(2,6-difluoro-4-hexylphenyl)cyclohexyl]ethynyl]-1,2,3,8-tetrafluoronaphthalene (PubChem CID 139847124) has the molecular formula C30H28F6 and a molecular weight of 502.54 g/mol. Its IUPAC name is 6-[2-[4-(2,6-difluoro-4-hexylphenyl)cyclohexyl]ethynyl]-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-[2-[4-(2,6-difluoro-4-hexylphenyl)cyclohexyl]ethynyl]-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 139847124 |
| Molecular Formula | C30H28F6 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 6-[2-[4-(2,6-difluoro-4-hexylphenyl)cyclohexyl]ethynyl]-1,2,3,8-tetrafluoronaphthalene |
| SMILES | CCCCCCc1cc(F)c(C2CCC(C#Cc3cc(F)c4c(F)c(F)c(F)cc4c3)CC2)c(F)c1 |
| InChI | InChI=1S/C30H28F6/c1-2-3-4-5-6-19-14-23(31)27(24(32)15-19)21-11-9-18(10-12-21)7-8-20-13-22-17-26(34)29(35)30(36)28(22)25(33)16-20/h13-18,21H,2-6,9-12H2,1H3 |
| InChIKey | MPRDIIOCHSCHGQ-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|