C26H21F5 — CID 139846733
6-[2-[4-(4-ethyl-2-fluorophenyl)cyclohexyl]ethynyl]-1,2,3,8-tetrafluoronaphthalene (PubChem CID 139846733) has the molecular formula C26H21F5 and a molecular weight of 428.44 g/mol. Its IUPAC name is 6-[2-[4-(4-ethyl-2-fluorophenyl)cyclohexyl]ethynyl]-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-[2-[4-(4-ethyl-2-fluorophenyl)cyclohexyl]ethynyl]-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 139846733 |
| Molecular Formula | C26H21F5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 6-[2-[4-(4-ethyl-2-fluorophenyl)cyclohexyl]ethynyl]-1,2,3,8-tetrafluoronaphthalene |
| SMILES | CCc1ccc(C2CCC(C#Cc3cc(F)c4c(F)c(F)c(F)cc4c3)CC2)c(F)c1 |
| InChI | InChI=1S/C26H21F5/c1-2-15-7-10-20(21(27)12-15)18-8-5-16(6-9-18)3-4-17-11-19-14-23(29)25(30)26(31)24(19)22(28)13-17/h7,10-14,16,18H,2,5-6,8-9H2,1H3 |
| InChIKey | CAGAIVDMPHBCBR-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|